C9H5N9O6 — CID 4996484
4-nitro-3,5-bis(1-nitropyrazol-4-yl)-1H-pyrazole (PubChem CID 4996484) has the molecular formula C9H5N9O6 and a molecular weight of 335.20 g/mol. Its IUPAC name is 4-nitro-3,5-bis(1-nitropyrazol-4-yl)-1H-pyrazole.
| Compound Name | 4-nitro-3,5-bis(1-nitropyrazol-4-yl)-1H-pyrazole |
|---|---|
| PubChem CID | 4996484 |
| Molecular Formula | C9H5N9O6 |
| Molecular Weight | 335.20 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 4-nitro-3,5-bis(1-nitropyrazol-4-yl)-1H-pyrazole |
| SMILES | O=[N+]([O-])c1c(-c2cnn([N+](=O)[O-])c2)n[nH]c1-c1cnn([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H5N9O6/c19-16(20)9-7(5-1-10-14(3-5)17(21)22)12-13-8(9)6-2-11-15(4-6)18(23)24/h1-4H,(H,12,13) |
| InChIKey | UBBYYFZSKCYOBC-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 193.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.20 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|