C5HN5O2 — CID 71623821
2-nitro-1H-imidazole-4,5-dicarbonitrile (PubChem CID 71623821) has the molecular formula C5HN5O2 and a molecular weight of 163.10 g/mol. Its IUPAC name is 2-nitro-1H-imidazole-4,5-dicarbonitrile.
| Compound Name | 2-nitro-1H-imidazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 71623821 |
| Molecular Formula | C5HN5O2 |
| Molecular Weight | 163.10 g/mol |
| Exact Mass | 163.01 |
| IUPAC Name | 2-nitro-1H-imidazole-4,5-dicarbonitrile |
| SMILES | N#Cc1nc([N+](=O)[O-])[nH]c1C#N |
| InChI | InChI=1S/C5HN5O2/c6-1-3-4(2-7)9-5(8-3)10(11)12/h(H,8,9) |
| InChIKey | RHEFLWRCYOAOTQ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 119.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.10 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|