C10H2N10 — CID 135840335
2-[(E)-(4,5-dicyano-1H-imidazol-2-yl)diazenyl]-1H-imidazole-4,5-dicarbonitrile (PubChem CID 135840335) has the molecular formula C10H2N10 and a molecular weight of 262.20 g/mol. Its IUPAC name is 2-[(E)-(4,5-dicyano-1H-imidazol-2-yl)diazenyl]-1H-imidazole-4,5-dicarbonitrile.
| Compound Name | 2-[(E)-(4,5-dicyano-1H-imidazol-2-yl)diazenyl]-1H-imidazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 135840335 |
| Molecular Formula | C10H2N10 |
| Molecular Weight | 262.20 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 2-[(E)-(4,5-dicyano-1H-imidazol-2-yl)diazenyl]-1H-imidazole-4,5-dicarbonitrile |
| SMILES | N#Cc1nc(/N=N/c2nc(C#N)c(C#N)[nH]2)[nH]c1C#N |
| InChI | InChI=1S/C10H2N10/c11-1-5-6(2-12)16-9(15-5)19-20-10-17-7(3-13)8(4-14)18-10/h(H,15,16)(H,17,18)/b20-19+ |
| InChIKey | JQIIMYALPQHBCL-FMQUCBEESA-N |
| XLogP | 1.03 |
| TPSA | 177.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.20 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|