C10H7N5O2 — CID 10633155
3-amino-5-(3-nitrophenyl)-1H-pyrazole-4-carbonitrile (PubChem CID 10633155) has the molecular formula C10H7N5O2 and a molecular weight of 229.20 g/mol. Its IUPAC name is 3-amino-5-(3-nitrophenyl)-1H-pyrazole-4-carbonitrile.
| Compound Name | 3-amino-5-(3-nitrophenyl)-1H-pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 10633155 |
| Molecular Formula | C10H7N5O2 |
| Molecular Weight | 229.20 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 3-amino-5-(3-nitrophenyl)-1H-pyrazole-4-carbonitrile |
| SMILES | N#Cc1c(N)n[nH]c1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H7N5O2/c11-5-8-9(13-14-10(8)12)6-2-1-3-7(4-6)15(16)17/h1-4H,(H3,12,13,14) |
| InChIKey | XYWSZKIAWRHUDV-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 121.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.20 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|