C19H8F5N5O3 — CID 40844732
(4R)-6-amino-3-(3-nitrophenyl)-4-(2,3,4,5,6-pentafluorophenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile (PubChem CID 40844732) has the molecular formula C19H8F5N5O3 and a molecular weight of 449.30 g/mol. Its IUPAC name is (4R)-6-amino-3-(3-nitrophenyl)-4-(2,3,4,5,6-pentafluorophenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile.
| Compound Name | (4R)-6-amino-3-(3-nitrophenyl)-4-(2,3,4,5,6-pentafluorophenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 40844732 |
| Molecular Formula | C19H8F5N5O3 |
| Molecular Weight | 449.30 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | (4R)-6-amino-3-(3-nitrophenyl)-4-(2,3,4,5,6-pentafluorophenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
| SMILES | N#CC1=C(N)Oc2n[nH]c(-c3cccc([N+](=O)[O-])c3)c2[C@@H]1c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C19H8F5N5O3/c20-12-10(13(21)15(23)16(24)14(12)22)9-8(5-25)18(26)32-19-11(9)17(27-28-19)6-2-1-3-7(4-6)29(30)31/h1-4,9H,26H2,(H,27,28)/t9-/m0/s1 |
| InChIKey | SBIOGPBPLHCMPV-VIFPVBQESA-N |
| XLogP | 3.90 |
| TPSA | 130.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.30 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|