C20H14ClN5O4 — CID 1414854
(4R)-6-amino-4-(2-chloro-6-nitrophenyl)-3-(3-methoxyphenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile (PubChem CID 1414854) has the molecular formula C20H14ClN5O4 and a molecular weight of 423.82 g/mol. Its IUPAC name is (4R)-6-amino-4-(2-chloro-6-nitrophenyl)-3-(3-methoxyphenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile.
| Compound Name | (4R)-6-amino-4-(2-chloro-6-nitrophenyl)-3-(3-methoxyphenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 1414854 |
| Molecular Formula | C20H14ClN5O4 |
| Molecular Weight | 423.82 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | (4R)-6-amino-4-(2-chloro-6-nitrophenyl)-3-(3-methoxyphenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
| SMILES | COc1cccc(-c2[nH]nc3c2[C@H](c2c(Cl)cccc2[N+](=O)[O-])C(C#N)=C(N)O3)c1 |
| InChI | InChI=1S/C20H14ClN5O4/c1-29-11-5-2-4-10(8-11)18-17-15(12(9-22)19(23)30-20(17)25-24-18)16-13(21)6-3-7-14(16)26(27)28/h2-8,15H,23H2,1H3,(H,24,25)/t15-/m0/s1 |
| InChIKey | PUGDDFQVKPGVBA-HNNXBMFYSA-N |
| XLogP | 3.87 |
| TPSA | 140.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.82 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|