C22H19N5O6 — CID 92848175
(4R)-6-amino-3-(3-nitrophenyl)-4-(2,4,6-trimethoxyphenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile (PubChem CID 92848175) has the molecular formula C22H19N5O6 and a molecular weight of 449.42 g/mol. Its IUPAC name is (4R)-6-amino-3-(3-nitrophenyl)-4-(2,4,6-trimethoxyphenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile.
| Compound Name | (4R)-6-amino-3-(3-nitrophenyl)-4-(2,4,6-trimethoxyphenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 92848175 |
| Molecular Formula | C22H19N5O6 |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | (4R)-6-amino-3-(3-nitrophenyl)-4-(2,4,6-trimethoxyphenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
| SMILES | COc1cc(OC)c([C@@H]2C(C#N)=C(N)Oc3n[nH]c(-c4cccc([N+](=O)[O-])c4)c32)c(OC)c1 |
| InChI | InChI=1S/C22H19N5O6/c1-30-13-8-15(31-2)18(16(9-13)32-3)17-14(10-23)21(24)33-22-19(17)20(25-26-22)11-5-4-6-12(7-11)27(28)29/h4-9,17H,24H2,1-3H3,(H,25,26)/t17-/m0/s1 |
| InChIKey | PNQNEDLMLRRRQA-KRWDZBQOSA-N |
| XLogP | 3.23 |
| TPSA | 158.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|