C18H12N6O3 — CID 1371381
(4S)-6-amino-3-(3-nitrophenyl)-4-pyridin-4-yl-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile (PubChem CID 1371381) has the molecular formula C18H12N6O3 and a molecular weight of 360.33 g/mol. Its IUPAC name is (4S)-6-amino-3-(3-nitrophenyl)-4-pyridin-4-yl-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile.
| Compound Name | (4S)-6-amino-3-(3-nitrophenyl)-4-pyridin-4-yl-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 1371381 |
| Molecular Formula | C18H12N6O3 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | (4S)-6-amino-3-(3-nitrophenyl)-4-pyridin-4-yl-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
| SMILES | N#CC1=C(N)Oc2n[nH]c(-c3cccc([N+](=O)[O-])c3)c2[C@H]1c1ccncc1 |
| InChI | InChI=1S/C18H12N6O3/c19-9-13-14(10-4-6-21-7-5-10)15-16(22-23-18(15)27-17(13)20)11-2-1-3-12(8-11)24(25)26/h1-8,14H,20H2,(H,22,23)/t14-/m0/s1 |
| InChIKey | KAWJNAVIHGGEHF-AWEZNQCLSA-N |
| XLogP | 2.60 |
| TPSA | 143.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|