C20H15N5O4 — CID 1287442
(4R)-6-amino-3-(4-methoxyphenyl)-4-(2-nitrophenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile (PubChem CID 1287442) has the molecular formula C20H15N5O4 and a molecular weight of 389.37 g/mol. Its IUPAC name is (4R)-6-amino-3-(4-methoxyphenyl)-4-(2-nitrophenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile.
| Compound Name | (4R)-6-amino-3-(4-methoxyphenyl)-4-(2-nitrophenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 1287442 |
| Molecular Formula | C20H15N5O4 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | (4R)-6-amino-3-(4-methoxyphenyl)-4-(2-nitrophenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
| SMILES | COc1ccc(-c2[nH]nc3c2[C@H](c2ccccc2[N+](=O)[O-])C(C#N)=C(N)O3)cc1 |
| InChI | InChI=1S/C20H15N5O4/c1-28-12-8-6-11(7-9-12)18-17-16(13-4-2-3-5-15(13)25(26)27)14(10-21)19(22)29-20(17)24-23-18/h2-9,16H,22H2,1H3,(H,23,24)/t16-/m1/s1 |
| InChIKey | SZHOZKGDOOEKQN-MRXNPFEDSA-N |
| XLogP | 3.21 |
| TPSA | 140.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|