C19H15N3O5 — CID 7306103
(4R)-3-(4-methoxyphenyl)-4-(2-nitrophenyl)-4,5-dihydro-2H-pyrano[2,3-c]pyrazol-6-one (PubChem CID 7306103) has the molecular formula C19H15N3O5 and a molecular weight of 365.35 g/mol. Its IUPAC name is (4R)-3-(4-methoxyphenyl)-4-(2-nitrophenyl)-4,5-dihydro-2H-pyrano[2,3-c]pyrazol-6-one.
| Compound Name | (4R)-3-(4-methoxyphenyl)-4-(2-nitrophenyl)-4,5-dihydro-2H-pyrano[2,3-c]pyrazol-6-one |
|---|---|
| PubChem CID | 7306103 |
| Molecular Formula | C19H15N3O5 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | (4R)-3-(4-methoxyphenyl)-4-(2-nitrophenyl)-4,5-dihydro-2H-pyrano[2,3-c]pyrazol-6-one |
| SMILES | COc1ccc(-c2[nH]nc3c2[C@@H](c2ccccc2[N+](=O)[O-])CC(=O)O3)cc1 |
| InChI | InChI=1S/C19H15N3O5/c1-26-12-8-6-11(7-9-12)18-17-14(10-16(23)27-19(17)21-20-18)13-4-2-3-5-15(13)22(24)25/h2-9,14H,10H2,1H3,(H,20,21)/t14-/m1/s1 |
| InChIKey | KLCBKCZPQJAONC-CQSZACIVSA-N |
| XLogP | 3.43 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|