About (4S)-4-(4-fluorophenyl)-3-phenyl-4,5-dihydro-2H-pyrano[2,3-c]pyrazol-6-one
(4S)-4-(4-fluorophenyl)-3-phenyl-4,5-dihydro-2H-pyrano[2,3-c]pyrazol-6-one (PubChem CID 7306086) has the molecular formula C18H13FN2O2
and a molecular weight of 308.31 g/mol. Its IUPAC name is (4S)-4-(4-fluorophenyl)-3-phenyl-4,5-dihydro-2H-pyrano[2,3-c]pyrazol-6-one.
Molecular Properties
| Compound Name | (4S)-4-(4-fluorophenyl)-3-phenyl-4,5-dihydro-2H-pyrano[2,3-c]pyrazol-6-one |
| PubChem CID | 7306086 |
| Molecular Formula | C18H13FN2O2 |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | (4S)-4-(4-fluorophenyl)-3-phenyl-4,5-dihydro-2H-pyrano[2,3-c]pyrazol-6-one |
| SMILES | O=C1C[C@@H](c2ccc(F)cc2)c2c(n[nH]c2-c2ccccc2)O1 |
| InChI | InChI=1S/C18H13FN2O2/c19-13-8-6-11(7-9-13)14-10-15(22)23-18-16(14)17(20-21-18)12-4-2-1-3-5-12/h1-9,14H,10H2,(H,20,21)/t14-/m0/s1 |
| InChIKey | PBESAVWNRBLNRK-AWEZNQCLSA-N |
| XLogP | 3.66 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-4-(4-fluorophenyl)-3-phenyl-4,5-dihydro-2H-pyrano[2,3-c]pyrazol-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-(4-fluorophenyl)-3-phenyl-4,5-dihydro-2H-pyrano[2,3-c]pyrazol-6-one?
The IUPAC name of (4S)-4-(4-fluorophenyl)-3-phenyl-4,5-dihydro-2H-pyrano[2,3-c]pyrazol-6-one (CID 7306086) is (4S)-4-(4-fluorophenyl)-3-phenyl-4,5-dihydro-2H-pyrano[2,3-c]pyrazol-6-one.
What is the SMILES notation for (4S)-4-(4-fluorophenyl)-3-phenyl-4,5-dihydro-2H-pyrano[2,3-c]pyrazol-6-one?
The canonical SMILES for (4S)-4-(4-fluorophenyl)-3-phenyl-4,5-dihydro-2H-pyrano[2,3-c]pyrazol-6-one is O=C1C[C@@H](c2ccc(F)cc2)c2c(n[nH]c2-c2ccccc2)O1.
What is the InChIKey of (4S)-4-(4-fluorophenyl)-3-phenyl-4,5-dihydro-2H-pyrano[2,3-c]pyrazol-6-one?
The InChIKey is PBESAVWNRBLNRK-AWEZNQCLSA-N. The full InChI is InChI=1S/C18H13FN2O2/c19-13-8-6-11(7-9-13)14-10-15(22)23-18-16(14)17(20-21-18)12-4-2-1-3-5-12/h1-9,14H,10H2,(H,20,21)/t14-/m0/s1.
What are the key properties of (4S)-4-(4-fluorophenyl)-3-phenyl-4,5-dihydro-2H-pyrano[2,3-c]pyrazol-6-one?
(4S)-4-(4-fluorophenyl)-3-phenyl-4,5-dihydro-2H-pyrano[2,3-c]pyrazol-6-one has a molecular weight of 308.31 g/mol, XLogP of 3.66, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-(4-fluorophenyl)-3-phenyl-4,5-dihydro-2H-pyrano[2,3-c]pyrazol-6-one is sourced from PubChem (CID 7306086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).