C21H17N5O4 — CID 1423171
(4R)-6-amino-3-(4-ethoxyphenyl)-4-(2-nitrophenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile (PubChem CID 1423171) has the molecular formula C21H17N5O4 and a molecular weight of 403.40 g/mol. Its IUPAC name is (4R)-6-amino-3-(4-ethoxyphenyl)-4-(2-nitrophenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile.
| Compound Name | (4R)-6-amino-3-(4-ethoxyphenyl)-4-(2-nitrophenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 1423171 |
| Molecular Formula | C21H17N5O4 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | (4R)-6-amino-3-(4-ethoxyphenyl)-4-(2-nitrophenyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
| SMILES | CCOc1ccc(-c2[nH]nc3c2[C@H](c2ccccc2[N+](=O)[O-])C(C#N)=C(N)O3)cc1 |
| InChI | InChI=1S/C21H17N5O4/c1-2-29-13-9-7-12(8-10-13)19-18-17(14-5-3-4-6-16(14)26(27)28)15(11-22)20(23)30-21(18)25-24-19/h3-10,17H,2,23H2,1H3,(H,24,25)/t17-/m1/s1 |
| InChIKey | HENFJCNHOTXPOW-QGZVFWFLSA-N |
| XLogP | 3.60 |
| TPSA | 140.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|