C14H8F3N5O3 — CID 3515007
6-amino-4-(2-nitrophenyl)-3-(trifluoromethyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile (PubChem CID 3515007) has the molecular formula C14H8F3N5O3 and a molecular weight of 351.24 g/mol. Its IUPAC name is 6-amino-4-(2-nitrophenyl)-3-(trifluoromethyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile.
| Compound Name | 6-amino-4-(2-nitrophenyl)-3-(trifluoromethyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 3515007 |
| Molecular Formula | C14H8F3N5O3 |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 6-amino-4-(2-nitrophenyl)-3-(trifluoromethyl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
| SMILES | N#CC1=C(N)Oc2n[nH]c(C(F)(F)F)c2C1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H8F3N5O3/c15-14(16,17)11-10-9(6-3-1-2-4-8(6)22(23)24)7(5-18)12(19)25-13(10)21-20-11/h1-4,9H,19H2,(H,20,21) |
| InChIKey | SEWOXIDTACDITF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 130.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|