C24H16ClN5O4 — CID 51618554
(4S)-6-amino-3-(4-chlorophenyl)-4-[5-(2-methyl-4-nitrophenyl)furan-2-yl]-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile (PubChem CID 51618554) has the molecular formula C24H16ClN5O4 and a molecular weight of 473.88 g/mol. Its IUPAC name is (4S)-6-amino-3-(4-chlorophenyl)-4-[5-(2-methyl-4-nitrophenyl)furan-2-yl]-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile.
| Compound Name | (4S)-6-amino-3-(4-chlorophenyl)-4-[5-(2-methyl-4-nitrophenyl)furan-2-yl]-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 51618554 |
| Molecular Formula | C24H16ClN5O4 |
| Molecular Weight | 473.88 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | (4S)-6-amino-3-(4-chlorophenyl)-4-[5-(2-methyl-4-nitrophenyl)furan-2-yl]-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
| SMILES | Cc1cc([N+](=O)[O-])ccc1-c1ccc([C@H]2C(C#N)=C(N)Oc3n[nH]c(-c4ccc(Cl)cc4)c32)o1 |
| InChI | InChI=1S/C24H16ClN5O4/c1-12-10-15(30(31)32)6-7-16(12)18-8-9-19(33-18)20-17(11-26)23(27)34-24-21(20)22(28-29-24)13-2-4-14(25)5-3-13/h2-10,20H,27H2,1H3,(H,28,29)/t20-/m1/s1 |
| InChIKey | JXUGZQJVAMVKIP-HXUWFJFHSA-N |
| XLogP | 5.42 |
| TPSA | 144.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.88 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|