C11H10N4O — CID 69465742
3-amino-5-(3-methoxyphenyl)-1H-pyrazole-4-carbonitrile (PubChem CID 69465742) has the molecular formula C11H10N4O and a molecular weight of 214.23 g/mol. Its IUPAC name is 3-amino-5-(3-methoxyphenyl)-1H-pyrazole-4-carbonitrile.
| Compound Name | 3-amino-5-(3-methoxyphenyl)-1H-pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 69465742 |
| Molecular Formula | C11H10N4O |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 3-amino-5-(3-methoxyphenyl)-1H-pyrazole-4-carbonitrile |
| SMILES | COc1cccc(-c2[nH]nc(N)c2C#N)c1 |
| InChI | InChI=1S/C11H10N4O/c1-16-8-4-2-3-7(5-8)10-9(6-12)11(13)15-14-10/h2-5H,1H3,(H3,13,14,15) |
| InChIKey | KQRJXBXFDDXIHB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |