C6H3N5O4 — CID 54319685
4,7-dinitro-2H-benzotriazole (PubChem CID 54319685) has the molecular formula C6H3N5O4 and a molecular weight of 209.12 g/mol. Its IUPAC name is 4,7-dinitro-2H-benzotriazole.
| Compound Name | 4,7-dinitro-2H-benzotriazole |
|---|---|
| PubChem CID | 54319685 |
| Molecular Formula | C6H3N5O4 |
| Molecular Weight | 209.12 g/mol |
| Exact Mass | 209.02 |
| IUPAC Name | 4,7-dinitro-2H-benzotriazole |
| SMILES | O=[N+]([O-])c1ccc([N+](=O)[O-])c2n[nH]nc12 |
| InChI | InChI=1S/C6H3N5O4/c12-10(13)3-1-2-4(11(14)15)6-5(3)7-9-8-6/h1-2H,(H,7,8,9) |
| InChIKey | SQSYTPACMTTZAL-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.12 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|