C8H7N3O2S — CID 12998507
7-ethyl-4-nitro-2,1,3-benzothiadiazole (PubChem CID 12998507) has the molecular formula C8H7N3O2S and a molecular weight of 209.23 g/mol. Its IUPAC name is 7-ethyl-4-nitro-2,1,3-benzothiadiazole.
| Compound Name | 7-ethyl-4-nitro-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 12998507 |
| Molecular Formula | C8H7N3O2S |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | 7-ethyl-4-nitro-2,1,3-benzothiadiazole |
| SMILES | CCc1ccc([N+](=O)[O-])c2nsnc12 |
| InChI | InChI=1S/C8H7N3O2S/c1-2-5-3-4-6(11(12)13)8-7(5)9-14-10-8/h3-4H,2H2,1H3 |
| InChIKey | QCFIOCFAIIAKOQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|