C12H14N4O7S — CID 175688916
6-(hydroxymethyl)-3-[(4-nitro-2,1,3-benzothiadiazol-7-yl)amino]oxane-2,4,5-triol (PubChem CID 175688916) has the molecular formula C12H14N4O7S and a molecular weight of 358.33 g/mol. Its IUPAC name is 6-(hydroxymethyl)-3-[(4-nitro-2,1,3-benzothiadiazol-7-yl)amino]oxane-2,4,5-triol.
| Compound Name | 6-(hydroxymethyl)-3-[(4-nitro-2,1,3-benzothiadiazol-7-yl)amino]oxane-2,4,5-triol |
|---|---|
| PubChem CID | 175688916 |
| Molecular Formula | C12H14N4O7S |
| Molecular Weight | 358.33 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 6-(hydroxymethyl)-3-[(4-nitro-2,1,3-benzothiadiazol-7-yl)amino]oxane-2,4,5-triol |
| SMILES | O=[N+]([O-])c1ccc(NC2C(O)OC(CO)C(O)C2O)c2nsnc12 |
| InChI | InChI=1S/C12H14N4O7S/c17-3-6-10(18)11(19)9(12(20)23-6)13-4-1-2-5(16(21)22)8-7(4)14-24-15-8/h1-2,6,9-13,17-20H,3H2 |
| InChIKey | AGOCKIDZRZSDJC-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 171.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.33 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|