C12H14N4O6S — CID 155694612
(2R,3S,4R,5S)-2-(hydroxymethyl)-5-[(4-nitro-2,1,3-benzothiadiazol-7-yl)amino]oxane-3,4-diol (PubChem CID 155694612) has the molecular formula C12H14N4O6S and a molecular weight of 342.33 g/mol. Its IUPAC name is (2R,3S,4R,5S)-2-(hydroxymethyl)-5-[(4-nitro-2,1,3-benzothiadiazol-7-yl)amino]oxane-3,4-diol.
| Compound Name | (2R,3S,4R,5S)-2-(hydroxymethyl)-5-[(4-nitro-2,1,3-benzothiadiazol-7-yl)amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 155694612 |
| Molecular Formula | C12H14N4O6S |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | (2R,3S,4R,5S)-2-(hydroxymethyl)-5-[(4-nitro-2,1,3-benzothiadiazol-7-yl)amino]oxane-3,4-diol |
| SMILES | O=[N+]([O-])c1ccc(N[C@H]2CO[C@H](CO)[C@@H](O)[C@@H]2O)c2nsnc12 |
| InChI | InChI=1S/C12H14N4O6S/c17-3-8-12(19)11(18)6(4-22-8)13-5-1-2-7(16(20)21)10-9(5)14-23-15-10/h1-2,6,8,11-13,17-19H,3-4H2/t6-,8+,11+,12+/m0/s1 |
| InChIKey | IEXNIBHNDSPRQD-ILWYWAAHSA-N |
| XLogP | -0.51 |
| TPSA | 150.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|