C22H31ClN6O11S — CID 167448143
5-[(3-chloro-1,2,4-thiadiazol-5-yl)amino]-2-[2-[2-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]ethoxy]ethoxymethyl]oxane-3,4-diol (PubChem CID 167448143) has the molecular formula C22H31ClN6O11S and a molecular weight of 623.04 g/mol. Its IUPAC name is 5-[(3-chloro-1,2,4-thiadiazol-5-yl)amino]-2-[2-[2-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]ethoxy]ethoxymethyl]oxane-3,4-diol.
| Compound Name | 5-[(3-chloro-1,2,4-thiadiazol-5-yl)amino]-2-[2-[2-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]ethoxy]ethoxymethyl]oxane-3,4-diol |
|---|---|
| PubChem CID | 167448143 |
| Molecular Formula | C22H31ClN6O11S |
| Molecular Weight | 623.04 g/mol |
| Exact Mass | 622.15 |
| IUPAC Name | 5-[(3-chloro-1,2,4-thiadiazol-5-yl)amino]-2-[2-[2-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]ethoxy]ethoxymethyl]oxane-3,4-diol |
| SMILES | O=[N+]([O-])c1ccc(NCCOCCOCCOCCOCC2OCC(Nc3nc(Cl)ns3)C(O)C2O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H31ClN6O11S/c23-21-26-22(41-27-21)25-16-12-40-18(20(31)19(16)30)13-39-10-9-38-8-7-37-6-5-36-4-3-24-15-2-1-14(28(32)33)11-17(15)29(34)35/h1-2,11,16,18-20,24,30-31H,3-10,12-13H2,(H,25,26,27) |
| InChIKey | VUOTVZAFSUYTIZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 222.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.04 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|