C26H43N3O14 — CID 170424652
(2R,3R,4R)-2-[2-[2-[2-[2-[2-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxymethyl]oxane-3,4-diol (PubChem CID 170424652) has the molecular formula C26H43N3O14 and a molecular weight of 621.64 g/mol. Its IUPAC name is (2R,3R,4R)-2-[2-[2-[2-[2-[2-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxymethyl]oxane-3,4-diol.
| Compound Name | (2R,3R,4R)-2-[2-[2-[2-[2-[2-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxymethyl]oxane-3,4-diol |
|---|---|
| PubChem CID | 170424652 |
| Molecular Formula | C26H43N3O14 |
| Molecular Weight | 621.64 g/mol |
| Exact Mass | 621.27 |
| IUPAC Name | (2R,3R,4R)-2-[2-[2-[2-[2-[2-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxymethyl]oxane-3,4-diol |
| SMILES | O=[N+]([O-])c1ccc(NCCOCCOCCOCCOCCOCCOCCOC[C@H]2OCC[C@@H](O)[C@H]2O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H43N3O14/c30-24-3-5-43-25(26(24)31)20-42-18-17-41-16-15-40-14-13-39-12-11-38-10-9-37-8-7-36-6-4-27-22-2-1-21(28(32)33)19-23(22)29(34)35/h1-2,19,24-27,30-31H,3-18,20H2/t24-,25-,26-/m1/s1 |
| InChIKey | UOEJRBOAYCGDKR-TWJOJJKGSA-N |
| XLogP | 0.54 |
| TPSA | 212.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.64 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|