C15H21N3O9 — CID 131877614
(2R,3R,4R,6S)-4-[2-(2,4-dinitroanilino)ethyl]-2-(hydroxymethyl)-6-methoxyoxane-3,4-diol (PubChem CID 131877614) has the molecular formula C15H21N3O9 and a molecular weight of 387.35 g/mol. Its IUPAC name is (2R,3R,4R,6S)-4-[2-(2,4-dinitroanilino)ethyl]-2-(hydroxymethyl)-6-methoxyoxane-3,4-diol.
| Compound Name | (2R,3R,4R,6S)-4-[2-(2,4-dinitroanilino)ethyl]-2-(hydroxymethyl)-6-methoxyoxane-3,4-diol |
|---|---|
| PubChem CID | 131877614 |
| Molecular Formula | C15H21N3O9 |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | (2R,3R,4R,6S)-4-[2-(2,4-dinitroanilino)ethyl]-2-(hydroxymethyl)-6-methoxyoxane-3,4-diol |
| SMILES | CO[C@@H]1C[C@](O)(CCNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C15H21N3O9/c1-26-13-7-15(21,14(20)12(8-19)27-13)4-5-16-10-3-2-9(17(22)23)6-11(10)18(24)25/h2-3,6,12-14,16,19-21H,4-5,7-8H2,1H3/t12-,13+,14-,15-/m1/s1 |
| InChIKey | UTLAZCREAICBHB-LXTVHRRPSA-N |
| XLogP | 0.15 |
| TPSA | 177.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|