C27H25N3O11 — CID 101348760
[(2R,3S,4R,5R,6R)-4-benzoyloxy-5-(2,4-dinitroanilino)-2-(hydroxymethyl)-6-methoxyoxan-3-yl] benzoate (PubChem CID 101348760) has the molecular formula C27H25N3O11 and a molecular weight of 567.51 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-4-benzoyloxy-5-(2,4-dinitroanilino)-2-(hydroxymethyl)-6-methoxyoxan-3-yl] benzoate.
| Compound Name | [(2R,3S,4R,5R,6R)-4-benzoyloxy-5-(2,4-dinitroanilino)-2-(hydroxymethyl)-6-methoxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 101348760 |
| Molecular Formula | C27H25N3O11 |
| Molecular Weight | 567.51 g/mol |
| Exact Mass | 567.15 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-4-benzoyloxy-5-(2,4-dinitroanilino)-2-(hydroxymethyl)-6-methoxyoxan-3-yl] benzoate |
| SMILES | CO[C@@H]1O[C@H](CO)[C@@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H]1Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H25N3O11/c1-38-27-22(28-19-13-12-18(29(34)35)14-20(19)30(36)37)24(41-26(33)17-10-6-3-7-11-17)23(21(15-31)39-27)40-25(32)16-8-4-2-5-9-16/h2-14,21-24,27-28,31H,15H2,1H3/t21-,22-,23-,24-,27-/m1/s1 |
| InChIKey | FMHQSVOWKCXXQO-XMPCBSOPSA-N |
| XLogP | 3.10 |
| TPSA | 189.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.51 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|