C25H24N6O12 — CID 51055811
(2R,3S,4R,5R,6S)-4,5-bis(2,4-dinitroanilino)-2-(hydroxymethyl)-6-phenylmethoxyoxan-3-ol (PubChem CID 51055811) has the molecular formula C25H24N6O12 and a molecular weight of 600.50 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-4,5-bis(2,4-dinitroanilino)-2-(hydroxymethyl)-6-phenylmethoxyoxan-3-ol.
| Compound Name | (2R,3S,4R,5R,6S)-4,5-bis(2,4-dinitroanilino)-2-(hydroxymethyl)-6-phenylmethoxyoxan-3-ol |
|---|---|
| PubChem CID | 51055811 |
| Molecular Formula | C25H24N6O12 |
| Molecular Weight | 600.50 g/mol |
| Exact Mass | 600.15 |
| IUPAC Name | (2R,3S,4R,5R,6S)-4,5-bis(2,4-dinitroanilino)-2-(hydroxymethyl)-6-phenylmethoxyoxan-3-ol |
| SMILES | O=[N+]([O-])c1ccc(N[C@H]2[C@@H](OCc3ccccc3)O[C@H](CO)[C@@H](O)[C@@H]2Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H24N6O12/c32-12-21-24(33)22(26-17-8-6-15(28(34)35)10-19(17)30(38)39)23(25(43-21)42-13-14-4-2-1-3-5-14)27-18-9-7-16(29(36)37)11-20(18)31(40)41/h1-11,21-27,32-33H,12-13H2/t21-,22-,23-,24-,25+/m1/s1 |
| InChIKey | KYSCASZGDLLTAM-JYSSUKAJSA-N |
| XLogP | 2.88 |
| TPSA | 255.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.50 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|