C30H27NO9 — CID 126563840
[(2R,3S,4R,5R,6S)-4-benzoyloxy-2-(hydroxymethyl)-6-methoxy-5-[(2-oxochromen-7-yl)amino]oxan-3-yl] benzoate (PubChem CID 126563840) has the molecular formula C30H27NO9 and a molecular weight of 545.54 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-4-benzoyloxy-2-(hydroxymethyl)-6-methoxy-5-[(2-oxochromen-7-yl)amino]oxan-3-yl] benzoate.
| Compound Name | [(2R,3S,4R,5R,6S)-4-benzoyloxy-2-(hydroxymethyl)-6-methoxy-5-[(2-oxochromen-7-yl)amino]oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 126563840 |
| Molecular Formula | C30H27NO9 |
| Molecular Weight | 545.54 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-4-benzoyloxy-2-(hydroxymethyl)-6-methoxy-5-[(2-oxochromen-7-yl)amino]oxan-3-yl] benzoate |
| SMILES | CO[C@H]1O[C@H](CO)[C@@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H]1Nc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C30H27NO9/c1-36-30-25(31-21-14-12-18-13-15-24(33)37-22(18)16-21)27(40-29(35)20-10-6-3-7-11-20)26(23(17-32)38-30)39-28(34)19-8-4-2-5-9-19/h2-16,23,25-27,30-32H,17H2,1H3/t23-,25-,26-,27-,30+/m1/s1 |
| InChIKey | UGZKPDVCSSMSHA-GNVCQQPKSA-N |
| XLogP | 3.39 |
| TPSA | 133.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.54 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|