C15H17NO7 — CID 129087874
7-[[(4R,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one (PubChem CID 129087874) has the molecular formula C15H17NO7 and a molecular weight of 323.30 g/mol. Its IUPAC name is 7-[[(4R,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one.
| Compound Name | 7-[[(4R,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one |
|---|---|
| PubChem CID | 129087874 |
| Molecular Formula | C15H17NO7 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 7-[[(4R,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one |
| SMILES | O=c1ccc2ccc(NC3C(O)OC(CO)[C@@H](O)[C@@H]3O)cc2o1 |
| InChI | InChI=1S/C15H17NO7/c17-6-10-13(19)14(20)12(15(21)23-10)16-8-3-1-7-2-4-11(18)22-9(7)5-8/h1-5,10,12-17,19-21H,6H2/t10?,12?,13-,14-,15?/m1/s1 |
| InChIKey | LWFFLJACZJFFAR-JFLNDGTBSA-N |
| XLogP | -1.00 |
| TPSA | 132.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|