C16H16F3NO7 — CID 162565243
3-(trifluoromethyl)-7-[[(5R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one (PubChem CID 162565243) has the molecular formula C16H16F3NO7 and a molecular weight of 391.30 g/mol. Its IUPAC name is 3-(trifluoromethyl)-7-[[(5R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one.
| Compound Name | 3-(trifluoromethyl)-7-[[(5R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one |
|---|---|
| PubChem CID | 162565243 |
| Molecular Formula | C16H16F3NO7 |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 3-(trifluoromethyl)-7-[[(5R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one |
| SMILES | O=c1oc2cc(NC3C(O)OC(CO)[C@H](O)C3O)ccc2cc1C(F)(F)F |
| InChI | InChI=1S/C16H16F3NO7/c17-16(18,19)8-3-6-1-2-7(4-9(6)26-14(8)24)20-11-13(23)12(22)10(5-21)27-15(11)25/h1-4,10-13,15,20-23,25H,5H2/t10?,11?,12-,13?,15?/m0/s1 |
| InChIKey | KXNLONOCHSRZBP-IDTBKSBVSA-N |
| XLogP | 0.02 |
| TPSA | 132.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|