C18H21NO8 — CID 140782844
4-acetyl-3-methyl-7-[[(2S,4S,5R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one (PubChem CID 140782844) has the molecular formula C18H21NO8 and a molecular weight of 379.37 g/mol. Its IUPAC name is 4-acetyl-3-methyl-7-[[(2S,4S,5R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one.
| Compound Name | 4-acetyl-3-methyl-7-[[(2S,4S,5R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one |
|---|---|
| PubChem CID | 140782844 |
| Molecular Formula | C18H21NO8 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 4-acetyl-3-methyl-7-[[(2S,4S,5R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one |
| SMILES | CC(=O)c1c(C)c(=O)oc2cc(NC3[C@@H](O)OC(CO)[C@H](O)[C@H]3O)ccc12 |
| InChI | InChI=1S/C18H21NO8/c1-7-13(8(2)21)10-4-3-9(5-11(10)26-17(7)24)19-14-16(23)15(22)12(6-20)27-18(14)25/h3-5,12,14-16,18-20,22-23,25H,6H2,1-2H3/t12?,14?,15-,16-,18-/m0/s1 |
| InChIKey | QKMCLLBJPXWDML-XFXHAOAVSA-N |
| XLogP | -0.48 |
| TPSA | 149.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|