C16H19NO7 — CID 140782833
4-methyl-7-[[(2R,4R,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one (PubChem CID 140782833) has the molecular formula C16H19NO7 and a molecular weight of 337.33 g/mol. Its IUPAC name is 4-methyl-7-[[(2R,4R,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one.
| Compound Name | 4-methyl-7-[[(2R,4R,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one |
|---|---|
| PubChem CID | 140782833 |
| Molecular Formula | C16H19NO7 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 4-methyl-7-[[(2R,4R,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(NC3[C@H](O)OC(CO)[C@@H](O)[C@@H]3O)ccc12 |
| InChI | InChI=1S/C16H19NO7/c1-7-4-12(19)23-10-5-8(2-3-9(7)10)17-13-15(21)14(20)11(6-18)24-16(13)22/h2-5,11,13-18,20-22H,6H2,1H3/t11?,13?,14-,15-,16-/m1/s1 |
| InChIKey | QAINOMONCYLHEW-MKKQRFEJSA-N |
| XLogP | -0.69 |
| TPSA | 132.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|