C15H16INO7 — CID 129100348
4-iodo-7-[[(3S,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one (PubChem CID 129100348) has the molecular formula C15H16INO7 and a molecular weight of 449.20 g/mol. Its IUPAC name is 4-iodo-7-[[(3S,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one.
| Compound Name | 4-iodo-7-[[(3S,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one |
|---|---|
| PubChem CID | 129100348 |
| Molecular Formula | C15H16INO7 |
| Molecular Weight | 449.20 g/mol |
| Exact Mass | 449.00 |
| IUPAC Name | 4-iodo-7-[[(3S,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one |
| SMILES | O=c1cc(I)c2ccc(N[C@@H]3C(O)OC(CO)[C@@H](O)C3O)cc2o1 |
| InChI | InChI=1S/C15H16INO7/c16-8-4-11(19)23-9-3-6(1-2-7(8)9)17-12-14(21)13(20)10(5-18)24-15(12)22/h1-4,10,12-15,17-18,20-22H,5H2/t10?,12-,13+,14?,15?/m0/s1 |
| InChIKey | MRKUVZCZBGTWOK-VOFOUSNASA-N |
| XLogP | -0.39 |
| TPSA | 132.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.20 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|