C20H18F3NO7S — CID 162565244
3-thiophen-2-yl-4-(trifluoromethyl)-7-[[(5R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one (PubChem CID 162565244) has the molecular formula C20H18F3NO7S and a molecular weight of 473.43 g/mol. Its IUPAC name is 3-thiophen-2-yl-4-(trifluoromethyl)-7-[[(5R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one.
| Compound Name | 3-thiophen-2-yl-4-(trifluoromethyl)-7-[[(5R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one |
|---|---|
| PubChem CID | 162565244 |
| Molecular Formula | C20H18F3NO7S |
| Molecular Weight | 473.43 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | 3-thiophen-2-yl-4-(trifluoromethyl)-7-[[(5R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one |
| SMILES | O=c1oc2cc(NC3C(O)OC(CO)[C@H](O)C3O)ccc2c(C(F)(F)F)c1-c1cccs1 |
| InChI | InChI=1S/C20H18F3NO7S/c21-20(22,23)14-9-4-3-8(24-15-17(27)16(26)11(7-25)31-19(15)29)6-10(9)30-18(28)13(14)12-2-1-5-32-12/h1-6,11,15-17,19,24-27,29H,7H2/t11?,15?,16-,17?,19?/m0/s1 |
| InChIKey | AHTNCCWNZIYMRN-IXVAOKSJSA-N |
| XLogP | 1.75 |
| TPSA | 132.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.43 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|