C18H21NO7 — CID 140782853
4-cyclopropyl-7-[[(2R,4R,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one (PubChem CID 140782853) has the molecular formula C18H21NO7 and a molecular weight of 363.37 g/mol. Its IUPAC name is 4-cyclopropyl-7-[[(2R,4R,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one.
| Compound Name | 4-cyclopropyl-7-[[(2R,4R,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one |
|---|---|
| PubChem CID | 140782853 |
| Molecular Formula | C18H21NO7 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 4-cyclopropyl-7-[[(2R,4R,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one |
| SMILES | O=c1cc(C2CC2)c2ccc(NC3[C@H](O)OC(CO)[C@@H](O)[C@@H]3O)cc2o1 |
| InChI | InChI=1S/C18H21NO7/c20-7-13-16(22)17(23)15(18(24)26-13)19-9-3-4-10-11(8-1-2-8)6-14(21)25-12(10)5-9/h3-6,8,13,15-20,22-24H,1-2,7H2/t13?,15?,16-,17-,18-/m1/s1 |
| InChIKey | PWQHUVPZBZEHNC-NLZHUQCOSA-N |
| XLogP | -0.12 |
| TPSA | 132.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|