C16H16F3NO7 — CID 140782861
4-(trifluoromethyl)-7-[[(2R,4R,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one (PubChem CID 140782861) has the molecular formula C16H16F3NO7 and a molecular weight of 390.30 g/mol. Its IUPAC name is 4-(trifluoromethyl)-7-[[(2R,4R,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one.
| Compound Name | 4-(trifluoromethyl)-7-[[(2R,4R,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one |
|---|---|
| PubChem CID | 140782861 |
| Molecular Formula | C16H16F3NO7 |
| Molecular Weight | 390.30 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 4-(trifluoromethyl)-7-[[(2R,4R,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one |
| SMILES | O=c1cc(C(F)(F)[18F])c2ccc(NC3[C@H](O)OC(CO)[C@@H](O)[C@@H]3O)cc2o1 |
| InChI | InChI=1S/C16H16F3NO7/c17-16(18,19)8-4-11(22)26-9-3-6(1-2-7(8)9)20-12-14(24)13(23)10(5-21)27-15(12)25/h1-4,10,12-15,20-21,23-25H,5H2/t10?,12?,13-,14-,15-/m1/s1/i17-1 |
| InChIKey | WVECSVSDZGMOBQ-MCSVWSRLSA-N |
| XLogP | 0.02 |
| TPSA | 132.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.30 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|