C21H21NO7 — CID 140782809
3-phenyl-7-[[(2S,4S,5R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one (PubChem CID 140782809) has the molecular formula C21H21NO7 and a molecular weight of 399.40 g/mol. Its IUPAC name is 3-phenyl-7-[[(2S,4S,5R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one.
| Compound Name | 3-phenyl-7-[[(2S,4S,5R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one |
|---|---|
| PubChem CID | 140782809 |
| Molecular Formula | C21H21NO7 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 3-phenyl-7-[[(2S,4S,5R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one |
| SMILES | O=c1oc2cc(NC3[C@@H](O)OC(CO)[C@H](O)[C@H]3O)ccc2cc1-c1ccccc1 |
| InChI | InChI=1S/C21H21NO7/c23-10-16-18(24)19(25)17(21(27)29-16)22-13-7-6-12-8-14(11-4-2-1-3-5-11)20(26)28-15(12)9-13/h1-9,16-19,21-25,27H,10H2/t16?,17?,18-,19-,21-/m0/s1 |
| InChIKey | RUMZYFVMEHIQOJ-GYDUTDLZSA-N |
| XLogP | 0.67 |
| TPSA | 132.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|