C22H23NO6 — CID 157284183
3-phenyl-7-[[(2S,4S,5R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]-1H-naphthalen-2-one (PubChem CID 157284183) has the molecular formula C22H23NO6 and a molecular weight of 397.43 g/mol. Its IUPAC name is 3-phenyl-7-[[(2S,4S,5R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]-1H-naphthalen-2-one.
| Compound Name | 3-phenyl-7-[[(2S,4S,5R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 157284183 |
| Molecular Formula | C22H23NO6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 3-phenyl-7-[[(2S,4S,5R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]-1H-naphthalen-2-one |
| SMILES | O=C1Cc2cc(NC3[C@@H](O)OC(CO)[C@H](O)[C@H]3O)ccc2C=C1c1ccccc1 |
| InChI | InChI=1S/C22H23NO6/c24-11-18-20(26)21(27)19(22(28)29-18)23-15-7-6-13-9-16(12-4-2-1-3-5-12)17(25)10-14(13)8-15/h1-9,18-24,26-28H,10-11H2/t18?,19?,20-,21-,22-/m0/s1 |
| InChIKey | BAAKQZXMHJAVBE-PFHORGDFSA-N |
| XLogP | 0.56 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|