C23H25NO6 — CID 129099731
7-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]amino]-4-methyl-3-phenylchromen-2-one (PubChem CID 129099731) has the molecular formula C23H25NO6 and a molecular weight of 411.45 g/mol. Its IUPAC name is 7-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]amino]-4-methyl-3-phenylchromen-2-one.
| Compound Name | 7-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]amino]-4-methyl-3-phenylchromen-2-one |
|---|---|
| PubChem CID | 129099731 |
| Molecular Formula | C23H25NO6 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 7-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]amino]-4-methyl-3-phenylchromen-2-one |
| SMILES | Cc1c(-c2ccccc2)c(=O)oc2cc(NC3C(C)OC(CO)C(O)C3O)ccc12 |
| InChI | InChI=1S/C23H25NO6/c1-12-16-9-8-15(24-20-13(2)29-18(11-25)21(26)22(20)27)10-17(16)30-23(28)19(12)14-6-4-3-5-7-14/h3-10,13,18,20-22,24-27H,11H2,1-2H3 |
| InChIKey | BSULGNLMFBBIIP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 112.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|