C17H21NO6 — CID 129099727
7-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]amino]-3-methylchromen-2-one (PubChem CID 129099727) has the molecular formula C17H21NO6 and a molecular weight of 335.36 g/mol. Its IUPAC name is 7-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]amino]-3-methylchromen-2-one.
| Compound Name | 7-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]amino]-3-methylchromen-2-one |
|---|---|
| PubChem CID | 129099727 |
| Molecular Formula | C17H21NO6 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 7-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]amino]-3-methylchromen-2-one |
| SMILES | Cc1cc2ccc(NC3C(C)OC(CO)C(O)C3O)cc2oc1=O |
| InChI | InChI=1S/C17H21NO6/c1-8-5-10-3-4-11(6-12(10)24-17(8)22)18-14-9(2)23-13(7-19)15(20)16(14)21/h3-6,9,13-16,18-21H,7H2,1-2H3 |
| InChIKey | DZALCOQXAWHPHU-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 112.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|