C17H19NO8 — CID 129087927
3-acetyl-7-[[(4R,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one (PubChem CID 129087927) has the molecular formula C17H19NO8 and a molecular weight of 365.34 g/mol. Its IUPAC name is 3-acetyl-7-[[(4R,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one.
| Compound Name | 3-acetyl-7-[[(4R,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one |
|---|---|
| PubChem CID | 129087927 |
| Molecular Formula | C17H19NO8 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 3-acetyl-7-[[(4R,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one |
| SMILES | CC(=O)c1cc2ccc(NC3C(O)OC(CO)[C@@H](O)[C@@H]3O)cc2oc1=O |
| InChI | InChI=1S/C17H19NO8/c1-7(20)10-4-8-2-3-9(5-11(8)25-16(10)23)18-13-15(22)14(21)12(6-19)26-17(13)24/h2-5,12-15,17-19,21-22,24H,6H2,1H3/t12?,13?,14-,15-,17?/m1/s1 |
| InChIKey | LOYNGXFDLGSBFI-KDUKZITGSA-N |
| XLogP | -0.79 |
| TPSA | 149.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|