C36H29NO10 — CID 118450101
[(2S,5S)-2,3-dibenzoyloxy-5-hydroxy-6-[[(2-oxochromen-7-yl)amino]methyl]oxan-4-yl] benzoate (PubChem CID 118450101) has the molecular formula C36H29NO10 and a molecular weight of 635.63 g/mol. Its IUPAC name is [(2S,5S)-2,3-dibenzoyloxy-5-hydroxy-6-[[(2-oxochromen-7-yl)amino]methyl]oxan-4-yl] benzoate.
| Compound Name | [(2S,5S)-2,3-dibenzoyloxy-5-hydroxy-6-[[(2-oxochromen-7-yl)amino]methyl]oxan-4-yl] benzoate |
|---|---|
| PubChem CID | 118450101 |
| Molecular Formula | C36H29NO10 |
| Molecular Weight | 635.63 g/mol |
| Exact Mass | 635.18 |
| IUPAC Name | [(2S,5S)-2,3-dibenzoyloxy-5-hydroxy-6-[[(2-oxochromen-7-yl)amino]methyl]oxan-4-yl] benzoate |
| SMILES | O=C(OC1C(OC(=O)c2ccccc2)[C@@H](O)C(CNc2ccc3ccc(=O)oc3c2)O[C@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H29NO10/c38-29-19-17-22-16-18-26(20-27(22)43-29)37-21-28-30(39)31(45-33(40)23-10-4-1-5-11-23)32(46-34(41)24-12-6-2-7-13-24)36(44-28)47-35(42)25-14-8-3-9-15-25/h1-20,28,30-32,36-37,39H,21H2/t28?,30-,31?,32?,36-/m0/s1 |
| InChIKey | DCYDJXIMGSTNTB-BURHGLNISA-N |
| XLogP | 4.60 |
| TPSA | 150.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.63 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|