(2,3-dibenzoyloxy-5-hydroxy-6-methyloxan-4-yl) benzoate

C27H24O8 — CID 3660163

IUPAC(2,3-dibenzoyloxy-5-hydroxy-6-methyloxan-4-yl) benzoate
SMILESCC1OC(OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1O
InChIInChI=1S/C27H24O8/c1-17-21(28)22(33-24(29)18-11-5-2-6-12-18)23(34-25(30)19-13-7-3-8-14-19)27(32-17)35-26(31)20-15-9-4-10-16-20/h2-17,21-23,27-28H,1H3
InChIKeyKQGJMQCLDRXSBI-UHFFFAOYSA-N
MW476.48 g/mol
LogP3.40
Rot. Bonds6

About (2,3-dibenzoyloxy-5-hydroxy-6-methyloxan-4-yl) benzoate

(2,3-dibenzoyloxy-5-hydroxy-6-methyloxan-4-yl) benzoate (PubChem CID 3660163) has the molecular formula C27H24O8 and a molecular weight of 476.48 g/mol. Its IUPAC name is (2,3-dibenzoyloxy-5-hydroxy-6-methyloxan-4-yl) benzoate.

Molecular Properties

Compound Name(2,3-dibenzoyloxy-5-hydroxy-6-methyloxan-4-yl) benzoate
PubChem CID3660163
Molecular FormulaC27H24O8
Molecular Weight476.48 g/mol
Exact Mass476.15
IUPAC Name(2,3-dibenzoyloxy-5-hydroxy-6-methyloxan-4-yl) benzoate
SMILESCC1OC(OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1O
InChIInChI=1S/C27H24O8/c1-17-21(28)22(33-24(29)18-11-5-2-6-12-18)23(34-25(30)19-13-7-3-8-14-19)27(32-17)35-26(31)20-15-9-4-10-16-20/h2-17,21-23,27-28H,1H3
InChIKeyKQGJMQCLDRXSBI-UHFFFAOYSA-N
XLogP3.40
TPSA108.36 Ų
H-Bond Donors1
H-Bond Acceptors8
Rotatable Bonds6
Heavy Atoms35
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500476.48
LogP ≤ 53.40
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}

Analyze (2,3-dibenzoyloxy-5-hydroxy-6-methyloxan-4-yl) benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,3-dibenzoyloxy-5-hydroxy-6-methyloxan-4-yl) benzoate?
The IUPAC name of (2,3-dibenzoyloxy-5-hydroxy-6-methyloxan-4-yl) benzoate (CID 3660163) is (2,3-dibenzoyloxy-5-hydroxy-6-methyloxan-4-yl) benzoate.
What is the SMILES notation for (2,3-dibenzoyloxy-5-hydroxy-6-methyloxan-4-yl) benzoate?
The canonical SMILES for (2,3-dibenzoyloxy-5-hydroxy-6-methyloxan-4-yl) benzoate is CC1OC(OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1O.
What is the InChIKey of (2,3-dibenzoyloxy-5-hydroxy-6-methyloxan-4-yl) benzoate?
The InChIKey is KQGJMQCLDRXSBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H24O8/c1-17-21(28)22(33-24(29)18-11-5-2-6-12-18)23(34-25(30)19-13-7-3-8-14-19)27(32-17)35-26(31)20-15-9-4-10-16-20/h2-17,21-23,27-28H,1H3.
What are the key properties of (2,3-dibenzoyloxy-5-hydroxy-6-methyloxan-4-yl) benzoate?
(2,3-dibenzoyloxy-5-hydroxy-6-methyloxan-4-yl) benzoate has a molecular weight of 476.48 g/mol, XLogP of 3.40, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dibenzoyloxy-5-hydroxy-6-methyloxan-4-yl) benzoate is sourced from PubChem (CID 3660163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).