C21H22INO10 — CID 126591357
[(3S,5S,6S)-4,6-diacetyloxy-2-(hydroxymethyl)-5-[(3-iodo-2-oxochromen-7-yl)amino]oxan-3-yl] acetate (PubChem CID 126591357) has the molecular formula C21H22INO10 and a molecular weight of 575.31 g/mol. Its IUPAC name is [(3S,5S,6S)-4,6-diacetyloxy-2-(hydroxymethyl)-5-[(3-iodo-2-oxochromen-7-yl)amino]oxan-3-yl] acetate.
| Compound Name | [(3S,5S,6S)-4,6-diacetyloxy-2-(hydroxymethyl)-5-[(3-iodo-2-oxochromen-7-yl)amino]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 126591357 |
| Molecular Formula | C21H22INO10 |
| Molecular Weight | 575.31 g/mol |
| Exact Mass | 575.03 |
| IUPAC Name | [(3S,5S,6S)-4,6-diacetyloxy-2-(hydroxymethyl)-5-[(3-iodo-2-oxochromen-7-yl)amino]oxan-3-yl] acetate |
| SMILES | CC(=O)OC1[C@H](OC(C)=O)C(CO)O[C@@H](OC(C)=O)[C@H]1Nc1ccc2cc(I)c(=O)oc2c1 |
| InChI | InChI=1S/C21H22INO10/c1-9(25)29-18-16(8-24)33-21(31-11(3)27)17(19(18)30-10(2)26)23-13-5-4-12-6-14(22)20(28)32-15(12)7-13/h4-7,16-19,21,23-24H,8H2,1-3H3/t16?,17-,18+,19?,21+/m0/s1 |
| InChIKey | FLUDVNCSKZAFIY-LUSGACOLSA-N |
| XLogP | 1.32 |
| TPSA | 150.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|