C23H24INO11 — CID 129099797
[(3S,5S)-3,4,6-triacetyloxy-5-[(3-iodo-2-oxochromen-7-yl)amino]oxan-2-yl]methyl acetate (PubChem CID 129099797) has the molecular formula C23H24INO11 and a molecular weight of 617.35 g/mol. Its IUPAC name is [(3S,5S)-3,4,6-triacetyloxy-5-[(3-iodo-2-oxochromen-7-yl)amino]oxan-2-yl]methyl acetate.
| Compound Name | [(3S,5S)-3,4,6-triacetyloxy-5-[(3-iodo-2-oxochromen-7-yl)amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 129099797 |
| Molecular Formula | C23H24INO11 |
| Molecular Weight | 617.35 g/mol |
| Exact Mass | 617.04 |
| IUPAC Name | [(3S,5S)-3,4,6-triacetyloxy-5-[(3-iodo-2-oxochromen-7-yl)amino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(OC(C)=O)[C@@H](Nc2ccc3cc(I)c(=O)oc3c2)C(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H24INO11/c1-10(26)31-9-18-20(32-11(2)27)21(33-12(3)28)19(23(36-18)34-13(4)29)25-15-6-5-14-7-16(24)22(30)35-17(14)8-15/h5-8,18-21,23,25H,9H2,1-4H3/t18?,19-,20+,21?,23?/m0/s1 |
| InChIKey | SHKHGYIMXMXSHF-CCAOLAKBSA-N |
| XLogP | 1.89 |
| TPSA | 156.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|