C23H29IN2O10 — CID 23598267
[3,4,6-triacetyloxy-5-[2-[(4-iodobenzoyl)amino]ethylamino]oxan-2-yl]methyl acetate (PubChem CID 23598267) has the molecular formula C23H29IN2O10 and a molecular weight of 620.39 g/mol. Its IUPAC name is [3,4,6-triacetyloxy-5-[2-[(4-iodobenzoyl)amino]ethylamino]oxan-2-yl]methyl acetate.
| Compound Name | [3,4,6-triacetyloxy-5-[2-[(4-iodobenzoyl)amino]ethylamino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 23598267 |
| Molecular Formula | C23H29IN2O10 |
| Molecular Weight | 620.39 g/mol |
| Exact Mass | 620.09 |
| IUPAC Name | [3,4,6-triacetyloxy-5-[2-[(4-iodobenzoyl)amino]ethylamino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(OC(C)=O)C(NCCNC(=O)c2ccc(I)cc2)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C23H29IN2O10/c1-12(27)32-11-18-20(33-13(2)28)21(34-14(3)29)19(23(36-18)35-15(4)30)25-9-10-26-22(31)16-5-7-17(24)8-6-16/h5-8,18-21,23,25H,9-11H2,1-4H3,(H,26,31) |
| InChIKey | ZWCDAETYTRLAEG-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 155.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.39 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|