C23H24O13 — CID 22884035
[(2R,3S,4S,5R)-3,4,5-triacetyloxy-6-(7-hydroxy-2-oxochromen-3-yl)oxyoxan-2-yl]methyl acetate (PubChem CID 22884035) has the molecular formula C23H24O13 and a molecular weight of 508.43 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-3,4,5-triacetyloxy-6-(7-hydroxy-2-oxochromen-3-yl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R)-3,4,5-triacetyloxy-6-(7-hydroxy-2-oxochromen-3-yl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 22884035 |
| Molecular Formula | C23H24O13 |
| Molecular Weight | 508.43 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | [(2R,3S,4S,5R)-3,4,5-triacetyloxy-6-(7-hydroxy-2-oxochromen-3-yl)oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(Oc2cc3ccc(O)cc3oc2=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C23H24O13/c1-10(24)30-9-18-19(31-11(2)25)20(32-12(3)26)21(33-13(4)27)23(36-18)35-17-7-14-5-6-15(28)8-16(14)34-22(17)29/h5-8,18-21,23,28H,9H2,1-4H3/t18-,19+,20+,21-,23?/m1/s1 |
| InChIKey | NHIQBJJZJKBDJX-BXKYXYMLSA-N |
| XLogP | 0.96 |
| TPSA | 174.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.43 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|