C27H30O16 — CID 90660706
acetic acid;[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(7-acetyloxy-2-oxochromen-6-yl)oxyoxan-2-yl]methyl acetate (PubChem CID 90660706) has the molecular formula C27H30O16 and a molecular weight of 610.52 g/mol. Its IUPAC name is acetic acid;[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(7-acetyloxy-2-oxochromen-6-yl)oxyoxan-2-yl]methyl acetate.
| Compound Name | acetic acid;[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(7-acetyloxy-2-oxochromen-6-yl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 90660706 |
| Molecular Formula | C27H30O16 |
| Molecular Weight | 610.52 g/mol |
| Exact Mass | 610.15 |
| IUPAC Name | acetic acid;[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(7-acetyloxy-2-oxochromen-6-yl)oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)O.CC(=O)OC[C@H]1O[C@@H](Oc2cc3ccc(=O)oc3cc2OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C25H26O14.C2H4O2/c1-11(26)32-10-20-22(34-13(3)28)23(35-14(4)29)24(36-15(5)30)25(39-20)38-18-8-16-6-7-21(31)37-17(16)9-19(18)33-12(2)27;1-2(3)4/h6-9,20,22-25H,10H2,1-5H3;1H3,(H,3,4)/t20-,22-,23+,24-,25-;/m1./s1 |
| InChIKey | LEWXDONVPBNJBR-JLPKSSMLSA-N |
| XLogP | 1.27 |
| TPSA | 217.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.52 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|