C28H26FNO6 — CID 129099810
7-[[(2S,5S)-5-fluoro-2-methoxy-4-phenoxy-6-(phenoxymethyl)oxan-3-yl]amino]chromen-2-one (PubChem CID 129099810) has the molecular formula C28H26FNO6 and a molecular weight of 491.52 g/mol. Its IUPAC name is 7-[[(2S,5S)-5-fluoro-2-methoxy-4-phenoxy-6-(phenoxymethyl)oxan-3-yl]amino]chromen-2-one.
| Compound Name | 7-[[(2S,5S)-5-fluoro-2-methoxy-4-phenoxy-6-(phenoxymethyl)oxan-3-yl]amino]chromen-2-one |
|---|---|
| PubChem CID | 129099810 |
| Molecular Formula | C28H26FNO6 |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | 7-[[(2S,5S)-5-fluoro-2-methoxy-4-phenoxy-6-(phenoxymethyl)oxan-3-yl]amino]chromen-2-one |
| SMILES | CO[C@H]1OC(COc2ccccc2)[C@@H](F)C(Oc2ccccc2)C1Nc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C28H26FNO6/c1-32-28-26(30-19-14-12-18-13-15-24(31)35-22(18)16-19)27(34-21-10-6-3-7-11-21)25(29)23(36-28)17-33-20-8-4-2-5-9-20/h2-16,23,25-28,30H,17H2,1H3/t23?,25-,26?,27?,28+/m1/s1 |
| InChIKey | ZQWGQLZAHPLVOK-CRQUVIINSA-N |
| XLogP | 4.81 |
| TPSA | 79.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|