C23H22INO7 — CID 118450103
7-[[(6S,8aS)-8-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]amino]-3-iodochromen-2-one (PubChem CID 118450103) has the molecular formula C23H22INO7 and a molecular weight of 551.33 g/mol. Its IUPAC name is 7-[[(6S,8aS)-8-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]amino]-3-iodochromen-2-one.
| Compound Name | 7-[[(6S,8aS)-8-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]amino]-3-iodochromen-2-one |
|---|---|
| PubChem CID | 118450103 |
| Molecular Formula | C23H22INO7 |
| Molecular Weight | 551.33 g/mol |
| Exact Mass | 551.04 |
| IUPAC Name | 7-[[(6S,8aS)-8-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]amino]-3-iodochromen-2-one |
| SMILES | CO[C@H]1OC2COC(c3ccccc3)O[C@H]2C(O)C1Nc1ccc2cc(I)c(=O)oc2c1 |
| InChI | InChI=1S/C23H22INO7/c1-28-23-18(25-14-8-7-13-9-15(24)21(27)30-16(13)10-14)19(26)20-17(31-23)11-29-22(32-20)12-5-3-2-4-6-12/h2-10,17-20,22-23,25-26H,11H2,1H3/t17?,18?,19?,20-,22?,23+/m1/s1 |
| InChIKey | QKBBHDHXGUNCAV-DTQRRKOGSA-N |
| XLogP | 3.02 |
| TPSA | 99.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|