C24H25NO7 — CID 129100365
7-[[(6S,8aS)-8-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]amino]-4-methylchromen-2-one (PubChem CID 129100365) has the molecular formula C24H25NO7 and a molecular weight of 439.46 g/mol. Its IUPAC name is 7-[[(6S,8aS)-8-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]amino]-4-methylchromen-2-one.
| Compound Name | 7-[[(6S,8aS)-8-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]amino]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 129100365 |
| Molecular Formula | C24H25NO7 |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 7-[[(6S,8aS)-8-hydroxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]amino]-4-methylchromen-2-one |
| SMILES | CO[C@H]1OC2COC(c3ccccc3)O[C@H]2C(O)C1Nc1ccc2c(C)cc(=O)oc2c1 |
| InChI | InChI=1S/C24H25NO7/c1-13-10-19(26)30-17-11-15(8-9-16(13)17)25-20-21(27)22-18(31-24(20)28-2)12-29-23(32-22)14-6-4-3-5-7-14/h3-11,18,20-25,27H,12H2,1-2H3/t18?,20?,21?,22-,23?,24+/m1/s1 |
| InChIKey | RVMVMVWDRGKSSG-BEDPDEKYSA-N |
| XLogP | 2.73 |
| TPSA | 99.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|