C15H17NO6 — CID 147040543
7-[[(5S)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one (PubChem CID 147040543) has the molecular formula C15H17NO6 and a molecular weight of 307.30 g/mol. Its IUPAC name is 7-[[(5S)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one.
| Compound Name | 7-[[(5S)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one |
|---|---|
| PubChem CID | 147040543 |
| Molecular Formula | C15H17NO6 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 7-[[(5S)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]chromen-2-one |
| SMILES | O=c1ccc2ccc(NC3COC(CO)[C@@H](O)C3O)cc2o1 |
| InChI | InChI=1S/C15H17NO6/c17-6-12-15(20)14(19)10(7-21-12)16-9-3-1-8-2-4-13(18)22-11(8)5-9/h1-5,10,12,14-17,19-20H,6-7H2/t10?,12?,14?,15-/m1/s1 |
| InChIKey | AZJDXSGYEQSLNR-WVJOVKCBSA-N |
| XLogP | -0.31 |
| TPSA | 112.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|