C21H20N2O12 — CID 591303
[4-hydroxy-2-(hydroxymethyl)-6-methoxy-5-(4-nitrobenzoyl)oxyoxan-3-yl] 4-nitrobenzoate (PubChem CID 591303) has the molecular formula C21H20N2O12 and a molecular weight of 492.39 g/mol. Its IUPAC name is [4-hydroxy-2-(hydroxymethyl)-6-methoxy-5-(4-nitrobenzoyl)oxyoxan-3-yl] 4-nitrobenzoate.
| Compound Name | [4-hydroxy-2-(hydroxymethyl)-6-methoxy-5-(4-nitrobenzoyl)oxyoxan-3-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 591303 |
| Molecular Formula | C21H20N2O12 |
| Molecular Weight | 492.39 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | [4-hydroxy-2-(hydroxymethyl)-6-methoxy-5-(4-nitrobenzoyl)oxyoxan-3-yl] 4-nitrobenzoate |
| SMILES | COC1OC(CO)C(OC(=O)c2ccc([N+](=O)[O-])cc2)C(O)C1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H20N2O12/c1-32-21-18(35-20(27)12-4-8-14(9-5-12)23(30)31)16(25)17(15(10-24)33-21)34-19(26)11-2-6-13(7-3-11)22(28)29/h2-9,15-18,21,24-25H,10H2,1H3 |
| InChIKey | SQEZMTLXRFAKSE-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 197.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.39 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|